C25H31N3O5 — CID 171321741
acetic acid;N-[[(1S,5S,6R,7R)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 171321741) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is acetic acid;N-[[(1S,5S,6R,7R)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | acetic acid;N-[[(1S,5S,6R,7R)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171321741 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | acetic acid;N-[[(1S,5S,6R,7R)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | CC(=O)O.Cc1cc(CN2C[C@@H]3[C@H](CNC(=O)C=Cc4ccccc4)[C@H]4CC[C@]3(C2)O4)on1 |
| InChI | InChI=1S/C23H27N3O3.C2H4O2/c1-16-11-18(29-25-16)13-26-14-20-19(21-9-10-23(20,15-26)28-21)12-24-22(27)8-7-17-5-3-2-4-6-17;1-2(3)4/h2-8,11,19-21H,9-10,12-15H2,1H3,(H,24,27);1H3,(H,3,4)/t19-,20+,21+,23+;/m0./s1 |
| InChIKey | JGBIHFJQWINQSD-PRDIJZEFSA-N |
| XLogP | 2.88 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|