C25H32N4O6 — CID 171689585
formic acid;(E)-N-[[(1S,5S,6R,7R)-3-(2-imidazol-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 171689585) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is formic acid;(E)-N-[[(1S,5S,6R,7R)-3-(2-imidazol-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | formic acid;(E)-N-[[(1S,5S,6R,7R)-3-(2-imidazol-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171689585 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | formic acid;(E)-N-[[(1S,5S,6R,7R)-3-(2-imidazol-1-ylethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC[C@H]1[C@H]2CN(CCn3ccnc3)C[C@]23CC[C@H]1O3.O=CO.O=CO |
| InChI | InChI=1S/C23H28N4O2.2CH2O2/c28-22(7-6-18-4-2-1-3-5-18)25-14-19-20-15-27(13-12-26-11-10-24-17-26)16-23(20)9-8-21(19)29-23;2*2-1-3/h1-7,10-11,17,19-21H,8-9,12-16H2,(H,25,28);2*1H,(H,2,3)/b7-6+;;/t19-,20+,21+,23+;;/m0../s1 |
| InChIKey | XKLKTOSLNFWYKI-XFCLCVJGSA-N |
| XLogP | 1.59 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|