C21H27FN2O6 — CID 155940485
2-[(1S,5S,6R,7R)-6-[[3-(3-fluorophenyl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid;formic acid (PubChem CID 155940485) has the molecular formula C21H27FN2O6 and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-[(1S,5S,6R,7R)-6-[[3-(3-fluorophenyl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid;formic acid.
| Compound Name | 2-[(1S,5S,6R,7R)-6-[[3-(3-fluorophenyl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid;formic acid |
|---|---|
| PubChem CID | 155940485 |
| Molecular Formula | C21H27FN2O6 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[(1S,5S,6R,7R)-6-[[3-(3-fluorophenyl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid;formic acid |
| SMILES | O=C(O)CN1C[C@@H]2[C@H](CNC(=O)CCc3cccc(F)c3)[C@H]3CC[C@]2(C1)O3.O=CO |
| InChI | InChI=1S/C20H25FN2O4.CH2O2/c21-14-3-1-2-13(8-14)4-5-18(24)22-9-15-16-10-23(11-19(25)26)12-20(16)7-6-17(15)27-20;2-1-3/h1-3,8,15-17H,4-7,9-12H2,(H,22,24)(H,25,26);1H,(H,2,3)/t15-,16+,17+,20+;/m0./s1 |
| InChIKey | PCRQJCINVKJNIU-LJPVCTPKSA-N |
| XLogP | 1.14 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|