C19H23F3N2O2 — CID 155509379
N-[[(1S,5S,6R,7R)-3-[(2,4,5-trifluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide (PubChem CID 155509379) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(2,4,5-trifluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(2,4,5-trifluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
|---|---|
| PubChem CID | 155509379 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(2,4,5-trifluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]propanamide |
| SMILES | CCC(=O)NC[C@H]1[C@H]2CN(Cc3cc(F)c(F)cc3F)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C19H23F3N2O2/c1-2-18(25)23-7-12-13-9-24(10-19(13)4-3-17(12)26-19)8-11-5-15(21)16(22)6-14(11)20/h5-6,12-13,17H,2-4,7-10H2,1H3,(H,23,25)/t12-,13+,17+,19+/m0/s1 |
| InChIKey | FGGCTBUTYQABRR-CKFGLLJZSA-N |
| XLogP | 2.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|