C24H29N3O3 — CID 154823464
N-[[(1S,5S,6R,7R)-3-[(4-methoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-phenylacetamide (PubChem CID 154823464) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(4-methoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-phenylacetamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(4-methoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 154823464 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(4-methoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2-phenylacetamide |
| SMILES | COc1ccnc(CN2C[C@@H]3[C@H](CNC(=O)Cc4ccccc4)[C@H]4CC[C@]3(C2)O4)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-29-19-8-10-25-18(12-19)14-27-15-21-20(22-7-9-24(21,16-27)30-22)13-26-23(28)11-17-5-3-2-4-6-17/h2-6,8,10,12,20-22H,7,9,11,13-16H2,1H3,(H,26,28)/t20-,21+,22+,24+/m0/s1 |
| InChIKey | FJKGBZPZEUHZLC-JVNMPXIPSA-N |
| XLogP | 2.43 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |