C20H25N5O3S — CID 155496247
N-[[(1S,5S,6R,7R)-3-[(2-methoxy-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 155496247) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(2-methoxy-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(2-methoxy-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 155496247 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(2-methoxy-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | COc1cc(CN2C[C@@H]3[C@H](CNC(=O)c4nsnc4C)[C@H]4CC[C@]3(C2)O4)ccn1 |
| InChI | InChI=1S/C20H25N5O3S/c1-12-18(24-29-23-12)19(26)22-8-14-15-10-25(11-20(15)5-3-16(14)28-20)9-13-4-6-21-17(7-13)27-2/h4,6-7,14-16H,3,5,8-11H2,1-2H3,(H,22,26)/t14-,15+,16+,20+/m0/s1 |
| InChIKey | CISHXXOKINZMOP-QCBUCWTNSA-N |
| XLogP | 1.66 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |