C22H33N3O6 — CID 171712304
N-[[(1S,5S,6R,7R)-3-[(3,4-dimethoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid (PubChem CID 171712304) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(3,4-dimethoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(3,4-dimethoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid |
|---|---|
| PubChem CID | 171712304 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(3,4-dimethoxy-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid |
| SMILES | CCCC(=O)NC[C@H]1[C@H]2CN(Cc3nccc(OC)c3OC)C[C@]23CC[C@H]1O3.O=CO |
| InChI | InChI=1S/C21H31N3O4.CH2O2/c1-4-5-19(25)23-10-14-15-11-24(13-21(15)8-6-17(14)28-21)12-16-20(27-3)18(26-2)7-9-22-16;2-1-3/h7,9,14-15,17H,4-6,8,10-13H2,1-3H3,(H,23,25);1H,(H,2,3)/t14-,15+,17+,21+;/m0./s1 |
| InChIKey | YWKKOWSHAGCDFV-XWMAPEDISA-N |
| XLogP | 1.70 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|