C25H32N2O5 — CID 135102669
N-[[(1S,5S,6R,7R)-3-[(2,3-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 135102669) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(2,3-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(2,3-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 135102669 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(2,3-dimethoxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | COc1cccc(CN2C[C@@H]3[C@H](CNC(=O)c4cc(C)oc4C)[C@H]4CC[C@]3(C2)O4)c1OC |
| InChI | InChI=1S/C25H32N2O5/c1-15-10-18(16(2)31-15)24(28)26-11-19-20-13-27(14-25(20)9-8-21(19)32-25)12-17-6-5-7-22(29-3)23(17)30-4/h5-7,10,19-21H,8-9,11-14H2,1-4H3,(H,26,28)/t19-,20+,21+,25+/m0/s1 |
| InChIKey | LYKAOVAQPKHPGQ-UWHHFBIGSA-N |
| XLogP | 3.32 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |