C23H35N3O4 — CID 155939571
formic acid;4-methyl-N-[[(1S,5S,6R,7R)-3-[(3-methyl-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide (PubChem CID 155939571) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is formic acid;4-methyl-N-[[(1S,5S,6R,7R)-3-[(3-methyl-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide.
| Compound Name | formic acid;4-methyl-N-[[(1S,5S,6R,7R)-3-[(3-methyl-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 155939571 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | formic acid;4-methyl-N-[[(1S,5S,6R,7R)-3-[(3-methyl-2-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide |
| SMILES | Cc1cccnc1CN1C[C@@H]2[C@H](CNC(=O)CCC(C)C)[C@H]3CC[C@]2(C1)O3.O=CO |
| InChI | InChI=1S/C22H33N3O2.CH2O2/c1-15(2)6-7-21(26)24-11-17-18-12-25(13-19-16(3)5-4-10-23-19)14-22(18)9-8-20(17)27-22;2-1-3/h4-5,10,15,17-18,20H,6-9,11-14H2,1-3H3,(H,24,26);1H,(H,2,3)/t17-,18+,20+,22+;/m0./s1 |
| InChIKey | JULJVJWBFBAQNP-IQQQHYEFSA-N |
| XLogP | 2.62 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|