C21H30FN3O4 — CID 155937894
3-fluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbutyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-4-carboxamide;formic acid (PubChem CID 155937894) has the molecular formula C21H30FN3O4 and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-fluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbutyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-4-carboxamide;formic acid.
| Compound Name | 3-fluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbutyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 155937894 |
| Molecular Formula | C21H30FN3O4 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-fluoro-N-[[(1S,5S,6R,7R)-3-(3-methylbutyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyridine-4-carboxamide;formic acid |
| SMILES | CC(C)CCN1C[C@@H]2[C@H](CNC(=O)c3ccncc3F)[C@H]3CC[C@]2(C1)O3.O=CO |
| InChI | InChI=1S/C20H28FN3O2.CH2O2/c1-13(2)5-8-24-11-16-15(18-3-6-20(16,12-24)26-18)9-23-19(25)14-4-7-22-10-17(14)21;2-1-3/h4,7,10,13,15-16,18H,3,5-6,8-9,11-12H2,1-2H3,(H,23,25);1H,(H,2,3)/t15-,16+,18+,20+;/m0./s1 |
| InChIKey | GDJZFTLEOKOMRH-RTLZATOESA-N |
| XLogP | 2.18 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|