C20H28ClN3O2 — CID 155498110
N-[[(1S,5S,6R,7R)-3-[(3-chloro-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,2-dimethylpropanamide (PubChem CID 155498110) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(3-chloro-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(3-chloro-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 155498110 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(3-chloro-4-pyridinyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC[C@H]1[C@H]2CN(Cc3ccncc3Cl)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C20H28ClN3O2/c1-19(2,3)18(25)23-8-14-15-11-24(10-13-5-7-22-9-16(13)21)12-20(15)6-4-17(14)26-20/h5,7,9,14-15,17H,4,6,8,10-12H2,1-3H3,(H,23,25)/t14-,15+,17+,20+/m0/s1 |
| InChIKey | NROPSXNAKKBDMP-DKYLXPRQSA-N |
| XLogP | 2.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |