C23H32N4O4 — CID 163334516
formic acid;N-[[(1S,5S,6R,7R)-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 163334516) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is formic acid;N-[[(1S,5S,6R,7R)-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | formic acid;N-[[(1S,5S,6R,7R)-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 163334516 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | formic acid;N-[[(1S,5S,6R,7R)-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@H]1[C@H]2CN(Cc3cn4cc(C)ccc4n3)C[C@]23CC[C@H]1O3.O=CO |
| InChI | InChI=1S/C22H30N4O2.CH2O2/c1-3-4-21(27)23-9-17-18-13-25(14-22(18)8-7-19(17)28-22)11-16-12-26-10-15(2)5-6-20(26)24-16;2-1-3/h5-6,10,12,17-19H,3-4,7-9,11,13-14H2,1-2H3,(H,23,27);1H,(H,2,3)/t17-,18+,19+,22+;/m0./s1 |
| InChIKey | KMQFMRLDNAWPCG-UCXINICASA-N |
| XLogP | 2.24 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|