C18H25N3O4S — CID 169420427
2-[(1S,5S,6R,7R)-6-[[3-(2-methyl-1,3-thiazol-4-yl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid (PubChem CID 169420427) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[(1S,5S,6R,7R)-6-[[3-(2-methyl-1,3-thiazol-4-yl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid.
| Compound Name | 2-[(1S,5S,6R,7R)-6-[[3-(2-methyl-1,3-thiazol-4-yl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid |
|---|---|
| PubChem CID | 169420427 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[(1S,5S,6R,7R)-6-[[3-(2-methyl-1,3-thiazol-4-yl)propanoylamino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetic acid |
| SMILES | Cc1nc(CCC(=O)NC[C@H]2[C@H]3CN(CC(=O)O)C[C@]34CC[C@H]2O4)cs1 |
| InChI | InChI=1S/C18H25N3O4S/c1-11-20-12(9-26-11)2-3-16(22)19-6-13-14-7-21(8-17(23)24)10-18(14)5-4-15(13)25-18/h9,13-15H,2-8,10H2,1H3,(H,19,22)(H,23,24)/t13-,14+,15+,18+/m0/s1 |
| InChIKey | ASBUZZHZWISUKZ-LUXYFRNMSA-N |
| XLogP | 1.06 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |