C24H27N3O3 — CID 155499567
4-N-[[(1S,5S,6R,7R)-3-benzyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzene-1,4-dicarboxamide (PubChem CID 155499567) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-N-[[(1S,5S,6R,7R)-3-benzyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[[(1S,5S,6R,7R)-3-benzyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 155499567 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-N-[[(1S,5S,6R,7R)-3-benzyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NC[C@H]2[C@H]3CN(Cc4ccccc4)C[C@]34CC[C@H]2O4)cc1 |
| InChI | InChI=1S/C24H27N3O3/c25-22(28)17-6-8-18(9-7-17)23(29)26-12-19-20-14-27(13-16-4-2-1-3-5-16)15-24(20)11-10-21(19)30-24/h1-9,19-21H,10-15H2,(H2,25,28)(H,26,29)/t19-,20+,21+,24+/m0/s1 |
| InChIKey | WCRUPDWNQGOWOQ-FBHSLPMESA-N |
| XLogP | 2.19 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |