C21H24N2O3S — CID 155497174
N-[[(1S,5S,6R,7R)-3-[(3-hydroxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide (PubChem CID 155497174) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(3-hydroxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(3-hydroxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 155497174 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(3-hydroxyphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NC[C@H]1[C@H]2CN(Cc3cccc(O)c3)C[C@]23CC[C@H]1O3)c1ccsc1 |
| InChI | InChI=1S/C21H24N2O3S/c24-16-3-1-2-14(8-16)10-23-11-18-17(19-4-6-21(18,13-23)26-19)9-22-20(25)15-5-7-27-12-15/h1-3,5,7-8,12,17-19,24H,4,6,9-11,13H2,(H,22,25)/t17-,18+,19+,21+/m0/s1 |
| InChIKey | DRLIDCQJEQHAMT-QEUVDIPISA-N |
| XLogP | 2.86 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |