C23H23N5O2 — CID 171325895
N-[[(1S,5S,6R,7R)-3-(3-cyanopyrazin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 171325895) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(3-cyanopyrazin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(3-cyanopyrazin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171325895 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(3-cyanopyrazin-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | N#Cc1nccnc1N1C[C@@H]2[C@H](CNC(=O)C=Cc3ccccc3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C23H23N5O2/c24-12-19-22(26-11-10-25-19)28-14-18-17(20-8-9-23(18,15-28)30-20)13-27-21(29)7-6-16-4-2-1-3-5-16/h1-7,10-11,17-18,20H,8-9,13-15H2,(H,27,29)/t17-,18+,20+,23+/m0/s1 |
| InChIKey | KWMSDKXRZFJCSA-XNSSQMBPSA-N |
| XLogP | 2.16 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|