C21H31N3O3 — CID 154822456
2-(3-methyl-1,2-oxazol-5-yl)-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide (PubChem CID 154822456) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide.
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 154822456 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)-N-[[(1S,5S,6R,7R)-3-(4-methylpent-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
| SMILES | CC(C)=CCCN1C[C@@H]2[C@H](CNC(=O)Cc3cc(C)no3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C21H31N3O3/c1-14(2)5-4-8-24-12-18-17(19-6-7-21(18,13-24)26-19)11-22-20(25)10-16-9-15(3)23-27-16/h5,9,17-19H,4,6-8,10-13H2,1-3H3,(H,22,25)/t17-,18+,19+,21+/m0/s1 |
| InChIKey | YYHBRPUYHDIRGG-QEUVDIPISA-N |
| XLogP | 2.48 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|