C21H30N4O2 — CID 171150625
N-[[(1S,5S,6R,7R)-3-(4-methylhex-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide (PubChem CID 171150625) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(4-methylhex-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(4-methylhex-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 171150625 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(4-methylhex-3-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pyrazine-2-carboxamide |
| SMILES | CCC(C)=CCCN1C[C@@H]2[C@H](CNC(=O)c3cnccn3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C21H30N4O2/c1-3-15(2)5-4-10-25-13-17-16(19-6-7-21(17,14-25)27-19)11-24-20(26)18-12-22-8-9-23-18/h5,8-9,12,16-17,19H,3-4,6-7,10-11,13-14H2,1-2H3,(H,24,26)/t16-,17+,19+,21+/m0/s1 |
| InChIKey | JNRRQYVRIXOKSH-GMLUQMLDSA-N |
| XLogP | 2.43 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|