C22H28N4O5 — CID 171338650
N-[[(1S,5S,6R,7R)-3-(cyclopent-3-ene-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methylpyrazine-2-carboxamide;formic acid (PubChem CID 171338650) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(cyclopent-3-ene-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methylpyrazine-2-carboxamide;formic acid.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(cyclopent-3-ene-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methylpyrazine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 171338650 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(cyclopent-3-ene-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5-methylpyrazine-2-carboxamide;formic acid |
| SMILES | Cc1cnc(C(=O)NC[C@H]2[C@H]3CN(C(=O)C4CC=CC4)C[C@]34CC[C@H]2O4)cn1.O=CO |
| InChI | InChI=1S/C21H26N4O3.CH2O2/c1-13-8-23-17(10-22-13)19(26)24-9-15-16-11-25(20(27)14-4-2-3-5-14)12-21(16)7-6-18(15)28-21;2-1-3/h2-3,8,10,14-16,18H,4-7,9,11-12H2,1H3,(H,24,26);1H,(H,2,3)/t15-,16+,18+,21+;/m0./s1 |
| InChIKey | NCQZBECVXXZART-ZUEGREAGSA-N |
| XLogP | 1.19 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|