C21H26F2N2O2 — CID 155499115
N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide (PubChem CID 155499115) has the molecular formula C21H26F2N2O2 and a molecular weight of 376.45 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 155499115 |
| Molecular Formula | C21H26F2N2O2 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,3-difluorobenzamide |
| SMILES | O=C(NC[C@H]1[C@H]2CN(C3CCCC3)C[C@]23CC[C@H]1O3)c1cccc(F)c1F |
| InChI | InChI=1S/C21H26F2N2O2/c22-17-7-3-6-14(19(17)23)20(26)24-10-15-16-11-25(13-4-1-2-5-13)12-21(16)9-8-18(15)27-21/h3,6-7,13,15-16,18H,1-2,4-5,8-12H2,(H,24,26)/t15-,16+,18+,21+/m0/s1 |
| InChIKey | MFSKOJNDZJVNMA-LTVCHDBBSA-N |
| XLogP | 3.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |