C21H32N4O2 — CID 155495486
N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,4,5-trimethylpyrazole-3-carboxamide (PubChem CID 155495486) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,4,5-trimethylpyrazole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,4,5-trimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155495486 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-cyclopentyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-2,4,5-trimethylpyrazole-3-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NC[C@H]2[C@H]3CN(C4CCCC4)C[C@]34CC[C@H]2O4)c1C |
| InChI | InChI=1S/C21H32N4O2/c1-13-14(2)23-24(3)19(13)20(26)22-10-16-17-11-25(15-6-4-5-7-15)12-21(17)9-8-18(16)27-21/h15-18H,4-12H2,1-3H3,(H,22,26)/t16-,17+,18+,21+/m0/s1 |
| InChIKey | HSQFSGAIIQIYGI-XKGFGPFHSA-N |
| XLogP | 2.19 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |