About piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone
piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone (PubChem CID 135092689) has the molecular formula C15H20N6O
and a molecular weight of 300.37 g/mol. Its IUPAC name is piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone.
Molecular Properties
| Compound Name | piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone |
| PubChem CID | 135092689 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone |
| SMILES | O=C(c1ccnc(NCCn2cncn2)c1)N1CCCCC1 |
| InChI | InChI=1S/C15H20N6O/c22-15(20-7-2-1-3-8-20)13-4-5-17-14(10-13)18-6-9-21-12-16-11-19-21/h4-5,10-12H,1-3,6-9H2,(H,17,18) |
| InChIKey | GKDWZZWORJNONJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone?
The IUPAC name of piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone (CID 135092689) is piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone.
What is the SMILES notation for piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone?
The canonical SMILES for piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone is O=C(c1ccnc(NCCn2cncn2)c1)N1CCCCC1.
What is the InChIKey of piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone?
The InChIKey is GKDWZZWORJNONJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6O/c22-15(20-7-2-1-3-8-20)13-4-5-17-14(10-13)18-6-9-21-12-16-11-19-21/h4-5,10-12H,1-3,6-9H2,(H,17,18).
What are the key properties of piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone?
piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone has a molecular weight of 300.37 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl-[2-[2-(1,2,4-triazol-1-yl)ethylamino]-4-pyridinyl]methanone is sourced from PubChem (CID 135092689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).