C15H18N4O — CID 53001379
piperidin-1-yl-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone (PubChem CID 53001379) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is piperidin-1-yl-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone.
| Compound Name | piperidin-1-yl-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 53001379 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | piperidin-1-yl-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Cn2cncn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C15H18N4O/c20-15(18-8-2-1-3-9-18)14-6-4-13(5-7-14)10-19-12-16-11-17-19/h4-7,11-12H,1-3,8-10H2 |
| InChIKey | HNGGICDARGMEFA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |