C22H23N5O2 — CID 24615839
N-phenyl-1-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]piperidine-3-carboxamide (PubChem CID 24615839) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-phenyl-1-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]piperidine-3-carboxamide.
| Compound Name | N-phenyl-1-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24615839 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-phenyl-1-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(C(=O)c2ccc(Cn3cncn3)cc2)C1 |
| InChI | InChI=1S/C22H23N5O2/c28-21(25-20-6-2-1-3-7-20)19-5-4-12-26(14-19)22(29)18-10-8-17(9-11-18)13-27-16-23-15-24-27/h1-3,6-11,15-16,19H,4-5,12-14H2,(H,25,28) |
| InChIKey | JLXNEYYPCSWSGK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |