C19H24N4O — CID 30938195
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone (PubChem CID 30938195) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 30938195 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[4-(1,2,4-triazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Cn2cncn2)cc1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C19H24N4O/c24-19(22-10-9-16-3-1-2-4-18(16)12-22)17-7-5-15(6-8-17)11-23-14-20-13-21-23/h5-8,13-14,16,18H,1-4,9-12H2/t16-,18-/m0/s1 |
| InChIKey | IPUSUODKXWCLMV-WMZOPIPTSA-N |
| XLogP | 2.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |