C21H31N3O — CID 135093357
(3aS,6aR)-5-[(1-butylbenzimidazol-2-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 135093357) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (3aS,6aR)-5-[(1-butylbenzimidazol-2-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aS,6aR)-5-[(1-butylbenzimidazol-2-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 135093357 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (3aS,6aR)-5-[(1-butylbenzimidazol-2-yl)methyl-methylamino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CCCCn1c(CN(C)C2C[C@H]3CC(O)C[C@H]3C2)nc2ccccc21 |
| InChI | InChI=1S/C21H31N3O/c1-3-4-9-24-20-8-6-5-7-19(20)22-21(24)14-23(2)17-10-15-12-18(25)13-16(15)11-17/h5-8,15-18,25H,3-4,9-14H2,1-2H3/t15-,16+,17?,18? |
| InChIKey | GUKKXNWEVYVGQP-OQSMONGASA-N |
| XLogP | 3.82 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |