C34H53N7O7 — CID 135095490
N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 135095490) has the molecular formula C34H53N7O7 and a molecular weight of 671.84 g/mol. Its IUPAC name is N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 135095490 |
| Molecular Formula | C34H53N7O7 |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.40 |
| IUPAC Name | N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)N[C@H]2CCCNC(=O)CN(C)C(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](C)NC(=O)[C@@H](C(C)C)NC2=O)CC1 |
| InChI | InChI=1S/C34H53N7O7/c1-22(2)29-33(46)36-23(3)30(43)38-27(20-24-10-7-6-8-11-24)34(47)40(4)21-28(42)35-15-9-12-26(32(45)39-29)37-31(44)25-13-16-41(17-14-25)18-19-48-5/h6-8,10-11,22-23,25-27,29H,9,12-21H2,1-5H3,(H,35,42)(H,36,46)(H,37,44)(H,38,43)(H,39,45)/t23-,26+,27+,29-/m1/s1 |
| InChIKey | ZECPAYKOCZVWFE-CHRXXPTBSA-N |
| XLogP | -0.43 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |