C31H40ClN7O6 — CID 135108541
N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-3-chloropyridine-4-carboxamide (PubChem CID 135108541) has the molecular formula C31H40ClN7O6 and a molecular weight of 642.16 g/mol. Its IUPAC name is N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-3-chloropyridine-4-carboxamide.
| Compound Name | N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 135108541 |
| Molecular Formula | C31H40ClN7O6 |
| Molecular Weight | 642.16 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | N-[(6S,9R,12R,15S)-6-benzyl-4,9-dimethyl-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazacyclooctadec-15-yl]-3-chloropyridine-4-carboxamide |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H](NC(=O)c2ccncc2Cl)CCCNC(=O)CN(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C31H40ClN7O6/c1-18(2)26-30(44)35-19(3)27(41)37-24(15-20-9-6-5-7-10-20)31(45)39(4)17-25(40)34-13-8-11-23(29(43)38-26)36-28(42)21-12-14-33-16-22(21)32/h5-7,9-10,12,14,16,18-19,23-24,26H,8,11,13,15,17H2,1-4H3,(H,34,40)(H,35,44)(H,36,42)(H,37,41)(H,38,43)/t19-,23+,24+,26-/m1/s1 |
| InChIKey | CBJYOWAXYVYYRT-POWYGARRSA-N |
| XLogP | 0.57 |
| TPSA | 178.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |