C20H23FN6O4 — CID 135097008
5-fluoro-9-oxa-1,12,13,14,19,22-hexazatetracyclo[20.2.2.112,15.03,8]heptacosa-3(8),4,6,13,15(27)-pentaene-2,18,21-trione (PubChem CID 135097008) has the molecular formula C20H23FN6O4 and a molecular weight of 430.44 g/mol. Its IUPAC name is 5-fluoro-9-oxa-1,12,13,14,19,22-hexazatetracyclo[20.2.2.112,15.03,8]heptacosa-3(8),4,6,13,15(27)-pentaene-2,18,21-trione.
| Compound Name | 5-fluoro-9-oxa-1,12,13,14,19,22-hexazatetracyclo[20.2.2.112,15.03,8]heptacosa-3(8),4,6,13,15(27)-pentaene-2,18,21-trione |
|---|---|
| PubChem CID | 135097008 |
| Molecular Formula | C20H23FN6O4 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 5-fluoro-9-oxa-1,12,13,14,19,22-hexazatetracyclo[20.2.2.112,15.03,8]heptacosa-3(8),4,6,13,15(27)-pentaene-2,18,21-trione |
| SMILES | O=C1CCc2cn(nn2)CCOc2ccc(F)cc2C(=O)N2CCN(CC2)C(=O)CN1 |
| InChI | InChI=1S/C20H23FN6O4/c21-14-1-3-17-16(11-14)20(30)26-7-5-25(6-8-26)19(29)12-22-18(28)4-2-15-13-27(24-23-15)9-10-31-17/h1,3,11,13H,2,4-10,12H2,(H,22,28) |
| InChIKey | QKBVMAALICPJLD-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |