C17H30N4O2 — CID 135098463
4-(azepan-1-yl)-N-(2-hydroxyethyl)-N-[(5-methyl-1H-imidazol-4-yl)methyl]butanamide (PubChem CID 135098463) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-(2-hydroxyethyl)-N-[(5-methyl-1H-imidazol-4-yl)methyl]butanamide.
| Compound Name | 4-(azepan-1-yl)-N-(2-hydroxyethyl)-N-[(5-methyl-1H-imidazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 135098463 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 4-(azepan-1-yl)-N-(2-hydroxyethyl)-N-[(5-methyl-1H-imidazol-4-yl)methyl]butanamide |
| SMILES | Cc1[nH]cnc1CN(CCO)C(=O)CCCN1CCCCCC1 |
| InChI | InChI=1S/C17H30N4O2/c1-15-16(19-14-18-15)13-21(11-12-22)17(23)7-6-10-20-8-4-2-3-5-9-20/h14,22H,2-13H2,1H3,(H,18,19) |
| InChIKey | IRKLXASGXDKPGP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |