C19H24N6O3 — CID 135099594
9-oxa-1,4,13,14,15,21-hexazatetracyclo[19.2.2.113,16.03,8]hexacosa-3(8),4,6,14,16(26)-pentaene-2,20-dione (PubChem CID 135099594) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 9-oxa-1,4,13,14,15,21-hexazatetracyclo[19.2.2.113,16.03,8]hexacosa-3(8),4,6,14,16(26)-pentaene-2,20-dione.
| Compound Name | 9-oxa-1,4,13,14,15,21-hexazatetracyclo[19.2.2.113,16.03,8]hexacosa-3(8),4,6,14,16(26)-pentaene-2,20-dione |
|---|---|
| PubChem CID | 135099594 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 9-oxa-1,4,13,14,15,21-hexazatetracyclo[19.2.2.113,16.03,8]hexacosa-3(8),4,6,14,16(26)-pentaene-2,20-dione |
| SMILES | O=C1CCCc2cn(nn2)CCCOc2cccnc2C(=O)N2CCN1CC2 |
| InChI | InChI=1S/C19H24N6O3/c26-17-6-1-4-15-14-25(22-21-15)8-3-13-28-16-5-2-7-20-18(16)19(27)24-11-9-23(17)10-12-24/h2,5,7,14H,1,3-4,6,8-13H2 |
| InChIKey | YRJDXMSLMJSDOJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |