C18H22N4O4 — CID 135100110
N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)-4-(morpholine-4-carbonyl)benzamide (PubChem CID 135100110) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)-4-(morpholine-4-carbonyl)benzamide.
| Compound Name | N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)-4-(morpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 135100110 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(1H-imidazol-2-ylmethyl)-4-(morpholine-4-carbonyl)benzamide |
| SMILES | O=C(c1ccc(C(=O)N(CCO)Cc2ncc[nH]2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H22N4O4/c23-10-7-22(13-16-19-5-6-20-16)18(25)15-3-1-14(2-4-15)17(24)21-8-11-26-12-9-21/h1-6,23H,7-13H2,(H,19,20) |
| InChIKey | LOLUCCTUWAAOKA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |