C15H12N2O5S2 — CID 1351008
(5E)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1351008) has the molecular formula C15H12N2O5S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is (5E)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1351008 |
| Molecular Formula | C15H12N2O5S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (5E)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-5-[(4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1CCN1C(=O)S/C(=C/c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C15H12N2O5S2/c18-10-3-1-9(2-4-10)7-11-13(20)17(15(22)24-11)6-5-16-12(19)8-23-14(16)21/h1-4,7,18H,5-6,8H2/b11-7+ |
| InChIKey | PVOQUCLGPAOZOK-YRNVUSSQSA-N |
| XLogP | 2.12 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|