C21H27N5O5 — CID 135101677
21-hydroxy-14-methoxy-11-oxa-1,6,7,8,19-pentazatetracyclo[19.3.1.15,8.012,17]hexacosa-5(26),6,12(17),13,15-pentaene-2,18-dione (PubChem CID 135101677) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 21-hydroxy-14-methoxy-11-oxa-1,6,7,8,19-pentazatetracyclo[19.3.1.15,8.012,17]hexacosa-5(26),6,12(17),13,15-pentaene-2,18-dione.
| Compound Name | 21-hydroxy-14-methoxy-11-oxa-1,6,7,8,19-pentazatetracyclo[19.3.1.15,8.012,17]hexacosa-5(26),6,12(17),13,15-pentaene-2,18-dione |
|---|---|
| PubChem CID | 135101677 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 21-hydroxy-14-methoxy-11-oxa-1,6,7,8,19-pentazatetracyclo[19.3.1.15,8.012,17]hexacosa-5(26),6,12(17),13,15-pentaene-2,18-dione |
| SMILES | COc1ccc2c(c1)OCCn1cc(nn1)CCC(=O)N1CCCC(O)(CNC2=O)C1 |
| InChI | InChI=1S/C21H27N5O5/c1-30-16-4-5-17-18(11-16)31-10-9-26-12-15(23-24-26)3-6-19(27)25-8-2-7-21(29,14-25)13-22-20(17)28/h4-5,11-12,29H,2-3,6-10,13-14H2,1H3,(H,22,28) |
| InChIKey | GGJWDSMEPPUFFI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |