C20H25N5O4 — CID 135118423
6-methyl-8,21-dioxa-1,11,12,13,18-pentazatetracyclo[18.3.1.13,7.111,14]hexacosa-3(26),4,6,12,14(25)-pentaene-2,17-dione (PubChem CID 135118423) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 6-methyl-8,21-dioxa-1,11,12,13,18-pentazatetracyclo[18.3.1.13,7.111,14]hexacosa-3(26),4,6,12,14(25)-pentaene-2,17-dione.
| Compound Name | 6-methyl-8,21-dioxa-1,11,12,13,18-pentazatetracyclo[18.3.1.13,7.111,14]hexacosa-3(26),4,6,12,14(25)-pentaene-2,17-dione |
|---|---|
| PubChem CID | 135118423 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 6-methyl-8,21-dioxa-1,11,12,13,18-pentazatetracyclo[18.3.1.13,7.111,14]hexacosa-3(26),4,6,12,14(25)-pentaene-2,17-dione |
| SMILES | Cc1ccc2cc1OCCn1cc(nn1)CCC(=O)NCC1CN(CCO1)C2=O |
| InChI | InChI=1S/C20H25N5O4/c1-14-2-3-15-10-18(14)29-9-7-25-12-16(22-23-25)4-5-19(26)21-11-17-13-24(20(15)27)6-8-28-17/h2-3,10,12,17H,4-9,11,13H2,1H3,(H,21,26) |
| InChIKey | QQPIMHPEWKUYNW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |