C20H25N5O3 — CID 135099863
9-oxa-1,12,13,14,19-pentazatetracyclo[18.2.2.14,8.112,15]hexacosa-4(26),5,7,13,15(25)-pentaene-2,18-dione (PubChem CID 135099863) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 9-oxa-1,12,13,14,19-pentazatetracyclo[18.2.2.14,8.112,15]hexacosa-4(26),5,7,13,15(25)-pentaene-2,18-dione.
| Compound Name | 9-oxa-1,12,13,14,19-pentazatetracyclo[18.2.2.14,8.112,15]hexacosa-4(26),5,7,13,15(25)-pentaene-2,18-dione |
|---|---|
| PubChem CID | 135099863 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 9-oxa-1,12,13,14,19-pentazatetracyclo[18.2.2.14,8.112,15]hexacosa-4(26),5,7,13,15(25)-pentaene-2,18-dione |
| SMILES | O=C1CCc2cn(nn2)CCOc2cccc(c2)CC(=O)N2CCC(CC2)N1 |
| InChI | InChI=1S/C20H25N5O3/c26-19-5-4-17-14-25(23-22-17)10-11-28-18-3-1-2-15(12-18)13-20(27)24-8-6-16(21-19)7-9-24/h1-3,12,14,16H,4-11,13H2,(H,21,26) |
| InChIKey | HYJOFLBTJSLRCM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |