C26H29N5O3 — CID 135089947
(5S,6S)-17,25-dioxa-3,9,20,21,22-pentazahexacyclo[24.2.2.13,6.112,16.120,23.05,9]tritriaconta-1(28),12(32),13,15,21,23(31),26,29-octaen-10-one (PubChem CID 135089947) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is (5S,6S)-17,25-dioxa-3,9,20,21,22-pentazahexacyclo[24.2.2.13,6.112,16.120,23.05,9]tritriaconta-1(28),12(32),13,15,21,23(31),26,29-octaen-10-one.
| Compound Name | (5S,6S)-17,25-dioxa-3,9,20,21,22-pentazahexacyclo[24.2.2.13,6.112,16.120,23.05,9]tritriaconta-1(28),12(32),13,15,21,23(31),26,29-octaen-10-one |
|---|---|
| PubChem CID | 135089947 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (5S,6S)-17,25-dioxa-3,9,20,21,22-pentazahexacyclo[24.2.2.13,6.112,16.120,23.05,9]tritriaconta-1(28),12(32),13,15,21,23(31),26,29-octaen-10-one |
| SMILES | O=C1Cc2cccc(c2)OCCn2cc(nn2)COc2ccc(cc2)CN2C[C@@H]3CCN1[C@@H]3C2 |
| InChI | InChI=1S/C26H29N5O3/c32-26-13-20-2-1-3-24(12-20)33-11-10-30-16-22(27-28-30)18-34-23-6-4-19(5-7-23)14-29-15-21-8-9-31(26)25(21)17-29/h1-7,12,16,21,25H,8-11,13-15,17-18H2/t21-,25+/m0/s1 |
| InChIKey | UQFDZSLWHYOXPJ-SQJMNOBHSA-N |
| XLogP | 2.52 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |