C30H36N6O4 — CID 131933414
(12R,15S)-12-benzyl-15-(cyclohexylmethyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.3.1.15,8]tricosa-1(21),6,8(23),18(22),19-pentaene-11,14,17-trione (PubChem CID 131933414) has the molecular formula C30H36N6O4 and a molecular weight of 544.66 g/mol. Its IUPAC name is (12R,15S)-12-benzyl-15-(cyclohexylmethyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.3.1.15,8]tricosa-1(21),6,8(23),18(22),19-pentaene-11,14,17-trione.
| Compound Name | (12R,15S)-12-benzyl-15-(cyclohexylmethyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.3.1.15,8]tricosa-1(21),6,8(23),18(22),19-pentaene-11,14,17-trione |
|---|---|
| PubChem CID | 131933414 |
| Molecular Formula | C30H36N6O4 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | (12R,15S)-12-benzyl-15-(cyclohexylmethyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.3.1.15,8]tricosa-1(21),6,8(23),18(22),19-pentaene-11,14,17-trione |
| SMILES | O=C1N[C@@H](CC2CCCCC2)C(=O)N[C@H](Cc2ccccc2)C(=O)NCc2cn(nn2)CCOc2cccc1c2 |
| InChI | InChI=1S/C30H36N6O4/c37-28-23-12-7-13-25(18-23)40-15-14-36-20-24(34-35-36)19-31-29(38)26(16-21-8-3-1-4-9-21)33-30(39)27(32-28)17-22-10-5-2-6-11-22/h1,3-4,7-9,12-13,18,20,22,26-27H,2,5-6,10-11,14-17,19H2,(H,31,38)(H,32,37)(H,33,39)/t26-,27+/m1/s1 |
| InChIKey | VKZQRXQWUJYRJH-SXOMAYOGSA-N |
| XLogP | 2.78 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |