C25H41N7O4 — CID 131900538
(7S,10R,13R)-7-(cyclohexylmethyl)-10-methyl-13-(2-methylpropyl)-1,6,9,12,15,18,19-heptazabicyclo[15.2.1]icosa-17(20),18-diene-5,8,11,14-tetrone (PubChem CID 131900538) has the molecular formula C25H41N7O4 and a molecular weight of 503.65 g/mol. Its IUPAC name is (7S,10R,13R)-7-(cyclohexylmethyl)-10-methyl-13-(2-methylpropyl)-1,6,9,12,15,18,19-heptazabicyclo[15.2.1]icosa-17(20),18-diene-5,8,11,14-tetrone.
| Compound Name | (7S,10R,13R)-7-(cyclohexylmethyl)-10-methyl-13-(2-methylpropyl)-1,6,9,12,15,18,19-heptazabicyclo[15.2.1]icosa-17(20),18-diene-5,8,11,14-tetrone |
|---|---|
| PubChem CID | 131900538 |
| Molecular Formula | C25H41N7O4 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | (7S,10R,13R)-7-(cyclohexylmethyl)-10-methyl-13-(2-methylpropyl)-1,6,9,12,15,18,19-heptazabicyclo[15.2.1]icosa-17(20),18-diene-5,8,11,14-tetrone |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)NC(=O)[C@H](CC2CCCCC2)NC(=O)CCCn2cc(nn2)CNC1=O |
| InChI | InChI=1S/C25H41N7O4/c1-16(2)12-20-24(35)26-14-19-15-32(31-30-19)11-7-10-22(33)28-21(13-18-8-5-4-6-9-18)25(36)27-17(3)23(34)29-20/h15-18,20-21H,4-14H2,1-3H3,(H,26,35)(H,27,36)(H,28,33)(H,29,34)/t17-,20-,21+/m1/s1 |
| InChIKey | DXVKLBYJOJKXQM-UIFIKXQLSA-N |
| XLogP | 1.18 |
| TPSA | 147.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |