C22H30N6O5 — CID 131915922
(12R,15R)-20-methoxy-12-methyl-15-(2-methylpropyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.2.2.15,8]tricosa-1(20),6,8(23),18,21-pentaene-11,14,17-trione (PubChem CID 131915922) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is (12R,15R)-20-methoxy-12-methyl-15-(2-methylpropyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.2.2.15,8]tricosa-1(20),6,8(23),18,21-pentaene-11,14,17-trione.
| Compound Name | (12R,15R)-20-methoxy-12-methyl-15-(2-methylpropyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.2.2.15,8]tricosa-1(20),6,8(23),18,21-pentaene-11,14,17-trione |
|---|---|
| PubChem CID | 131915922 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (12R,15R)-20-methoxy-12-methyl-15-(2-methylpropyl)-2-oxa-5,6,7,10,13,16-hexazatricyclo[16.2.2.15,8]tricosa-1(20),6,8(23),18,21-pentaene-11,14,17-trione |
| SMILES | COc1cc2ccc1OCCn1cc(nn1)CNC(=O)[C@@H](C)NC(=O)[C@@H](CC(C)C)NC2=O |
| InChI | InChI=1S/C22H30N6O5/c1-13(2)9-17-22(31)24-14(3)20(29)23-11-16-12-28(27-26-16)7-8-33-18-6-5-15(21(30)25-17)10-19(18)32-4/h5-6,10,12-14,17H,7-9,11H2,1-4H3,(H,23,29)(H,24,31)(H,25,30)/t14-,17-/m1/s1 |
| InChIKey | AGTGJXVGWDNSBB-RHSMWYFYSA-N |
| XLogP | 0.64 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|