C30H37N7O5 — CID 131907127
(13R,16S,19R)-19-benzyl-13-methyl-16-propan-2-yl-2-oxa-6,7,8,11,14,17,20-heptazatricyclo[20.2.2.16,9]heptacosa-1(25),7,9(27),22(26),23-pentaene-12,15,18,21-tetrone (PubChem CID 131907127) has the molecular formula C30H37N7O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is (13R,16S,19R)-19-benzyl-13-methyl-16-propan-2-yl-2-oxa-6,7,8,11,14,17,20-heptazatricyclo[20.2.2.16,9]heptacosa-1(25),7,9(27),22(26),23-pentaene-12,15,18,21-tetrone.
| Compound Name | (13R,16S,19R)-19-benzyl-13-methyl-16-propan-2-yl-2-oxa-6,7,8,11,14,17,20-heptazatricyclo[20.2.2.16,9]heptacosa-1(25),7,9(27),22(26),23-pentaene-12,15,18,21-tetrone |
|---|---|
| PubChem CID | 131907127 |
| Molecular Formula | C30H37N7O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | (13R,16S,19R)-19-benzyl-13-methyl-16-propan-2-yl-2-oxa-6,7,8,11,14,17,20-heptazatricyclo[20.2.2.16,9]heptacosa-1(25),7,9(27),22(26),23-pentaene-12,15,18,21-tetrone |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccc(cc2)OCCCn2cc(nn2)CNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C30H37N7O5/c1-19(2)26-30(41)32-20(3)27(38)31-17-23-18-37(36-35-23)14-7-15-42-24-12-10-22(11-13-24)28(39)33-25(29(40)34-26)16-21-8-5-4-6-9-21/h4-6,8-13,18-20,25-26H,7,14-17H2,1-3H3,(H,31,38)(H,32,41)(H,33,39)(H,34,40)/t20-,25-,26+/m1/s1 |
| InChIKey | HGAQFHJHHFXAMT-VANUSSGQSA-N |
| XLogP | 1.36 |
| TPSA | 156.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|