C29H35N7O5 — CID 131905928
(12S,15R)-15-methyl-12-propan-2-yl-26-oxa-3,11,14,17,20,21,22-heptazatetracyclo[25.2.2.15,9.119,22]tritriaconta-1(30),5(33),6,8,19(32),20,27(31),28-octaene-2,10,13,16-tetrone (PubChem CID 131905928) has the molecular formula C29H35N7O5 and a molecular weight of 561.64 g/mol. Its IUPAC name is (12S,15R)-15-methyl-12-propan-2-yl-26-oxa-3,11,14,17,20,21,22-heptazatetracyclo[25.2.2.15,9.119,22]tritriaconta-1(30),5(33),6,8,19(32),20,27(31),28-octaene-2,10,13,16-tetrone.
| Compound Name | (12S,15R)-15-methyl-12-propan-2-yl-26-oxa-3,11,14,17,20,21,22-heptazatetracyclo[25.2.2.15,9.119,22]tritriaconta-1(30),5(33),6,8,19(32),20,27(31),28-octaene-2,10,13,16-tetrone |
|---|---|
| PubChem CID | 131905928 |
| Molecular Formula | C29H35N7O5 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | (12S,15R)-15-methyl-12-propan-2-yl-26-oxa-3,11,14,17,20,21,22-heptazatetracyclo[25.2.2.15,9.119,22]tritriaconta-1(30),5(33),6,8,19(32),20,27(31),28-octaene-2,10,13,16-tetrone |
| SMILES | CC(C)[C@@H]1NC(=O)c2cccc(c2)CNC(=O)c2ccc(cc2)OCCCn2cc(nn2)CNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C29H35N7O5/c1-18(2)25-29(40)32-19(3)26(37)31-16-23-17-36(35-34-23)12-5-13-41-24-10-8-21(9-11-24)27(38)30-15-20-6-4-7-22(14-20)28(39)33-25/h4,6-11,14,17-19,25H,5,12-13,15-16H2,1-3H3,(H,30,38)(H,31,37)(H,32,40)(H,33,39)/t19-,25+/m1/s1 |
| InChIKey | KJOAJNZAQQKVNG-CLOONOSVSA-N |
| XLogP | 1.57 |
| TPSA | 156.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|