C21H27ClN6O4 — CID 131937627
(14R,17R)-8-chloro-17-methyl-14-propan-2-yl-5-oxa-1,13,16,19,22,23-hexazatricyclo[19.2.1.06,11]tetracosa-6(11),7,9,21(24),22-pentaene-12,15,18-trione (PubChem CID 131937627) has the molecular formula C21H27ClN6O4 and a molecular weight of 462.94 g/mol. Its IUPAC name is (14R,17R)-8-chloro-17-methyl-14-propan-2-yl-5-oxa-1,13,16,19,22,23-hexazatricyclo[19.2.1.06,11]tetracosa-6(11),7,9,21(24),22-pentaene-12,15,18-trione.
| Compound Name | (14R,17R)-8-chloro-17-methyl-14-propan-2-yl-5-oxa-1,13,16,19,22,23-hexazatricyclo[19.2.1.06,11]tetracosa-6(11),7,9,21(24),22-pentaene-12,15,18-trione |
|---|---|
| PubChem CID | 131937627 |
| Molecular Formula | C21H27ClN6O4 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (14R,17R)-8-chloro-17-methyl-14-propan-2-yl-5-oxa-1,13,16,19,22,23-hexazatricyclo[19.2.1.06,11]tetracosa-6(11),7,9,21(24),22-pentaene-12,15,18-trione |
| SMILES | CC(C)[C@H]1NC(=O)c2ccc(Cl)cc2OCCCn2cc(nn2)CNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C21H27ClN6O4/c1-12(2)18-21(31)24-13(3)19(29)23-10-15-11-28(27-26-15)7-4-8-32-17-9-14(22)5-6-16(17)20(30)25-18/h5-6,9,11-13,18H,4,7-8,10H2,1-3H3,(H,23,29)(H,24,31)(H,25,30)/t13-,18-/m1/s1 |
| InChIKey | ULDLWSMORCPRCI-FZKQIMNGSA-N |
| XLogP | 1.29 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |