C21H28N6O4S — CID 131890371
(13R,16R)-8,16-dimethyl-13-(2-methylsulfanylethyl)-4-oxa-1,12,15,18,21,22-hexazatricyclo[18.2.1.05,10]tricosa-5(10),6,8,20(23),21-pentaene-11,14,17-trione (PubChem CID 131890371) has the molecular formula C21H28N6O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is (13R,16R)-8,16-dimethyl-13-(2-methylsulfanylethyl)-4-oxa-1,12,15,18,21,22-hexazatricyclo[18.2.1.05,10]tricosa-5(10),6,8,20(23),21-pentaene-11,14,17-trione.
| Compound Name | (13R,16R)-8,16-dimethyl-13-(2-methylsulfanylethyl)-4-oxa-1,12,15,18,21,22-hexazatricyclo[18.2.1.05,10]tricosa-5(10),6,8,20(23),21-pentaene-11,14,17-trione |
|---|---|
| PubChem CID | 131890371 |
| Molecular Formula | C21H28N6O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (13R,16R)-8,16-dimethyl-13-(2-methylsulfanylethyl)-4-oxa-1,12,15,18,21,22-hexazatricyclo[18.2.1.05,10]tricosa-5(10),6,8,20(23),21-pentaene-11,14,17-trione |
| SMILES | CSCC[C@H]1NC(=O)c2cc(C)ccc2OCCn2cc(nn2)CNC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C21H28N6O4S/c1-13-4-5-18-16(10-13)20(29)24-17(6-9-32-3)21(30)23-14(2)19(28)22-11-15-12-27(26-25-15)7-8-31-18/h4-5,10,12,14,17H,6-9,11H2,1-3H3,(H,22,28)(H,23,30)(H,24,29)/t14-,17-/m1/s1 |
| InChIKey | QQRIGRARKWMACH-RHSMWYFYSA-N |
| XLogP | 0.65 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |