About 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one
6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one (PubChem CID 135107741) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one |
| PubChem CID | 135107741 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one |
| SMILES | COc1ccc2[nH]cc(C(=O)N3CCC[C@]4(CCC[C@H]4OC)C3)c(=O)c2c1 |
| InChI | InChI=1S/C21H26N2O4/c1-26-14-6-7-17-15(11-14)19(24)16(12-22-17)20(25)23-10-4-9-21(13-23)8-3-5-18(21)27-2/h6-7,11-12,18H,3-5,8-10,13H2,1-2H3,(H,22,24)/t18-,21-/m1/s1 |
| InChIKey | DOHLBYPEXOIZAK-WIYYLYMNSA-N |
| XLogP | 2.96 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one?
The IUPAC name of 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one (CID 135107741) is 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one.
What is the SMILES notation for 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one?
The canonical SMILES for 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one is COc1ccc2[nH]cc(C(=O)N3CCC[C@]4(CCC[C@H]4OC)C3)c(=O)c2c1.
What is the InChIKey of 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one?
The InChIKey is DOHLBYPEXOIZAK-WIYYLYMNSA-N. The full InChI is InChI=1S/C21H26N2O4/c1-26-14-6-7-17-15(11-14)19(24)16(12-22-17)20(25)23-10-4-9-21(13-23)8-3-5-18(21)27-2/h6-7,11-12,18H,3-5,8-10,13H2,1-2H3,(H,22,24)/t18-,21-/m1/s1.
What are the key properties of 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one?
6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one has a molecular weight of 370.45 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-[(4R,5R)-4-methoxy-7-azaspiro[4.5]decane-7-carbonyl]-1H-quinolin-4-one is sourced from PubChem (CID 135107741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).