C20H26N2O — CID 135109527
(3S,4R)-1-(4-methylpent-3-enyl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol (PubChem CID 135109527) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (3S,4R)-1-(4-methylpent-3-enyl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4R)-1-(4-methylpent-3-enyl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 135109527 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (3S,4R)-1-(4-methylpent-3-enyl)-4-(quinolin-4-ylmethyl)pyrrolidin-3-ol |
| SMILES | CC(C)=CCCN1C[C@@H](Cc2ccnc3ccccc23)[C@H](O)C1 |
| InChI | InChI=1S/C20H26N2O/c1-15(2)6-5-11-22-13-17(20(23)14-22)12-16-9-10-21-19-8-4-3-7-18(16)19/h3-4,6-10,17,20,23H,5,11-14H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | SLRYHQYRVMMGNX-YLJYHZDGSA-N |
| XLogP | 3.43 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|