About methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate
methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate (PubChem CID 155498400) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate |
| PubChem CID | 155498400 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CN2C[C@@H](Cc3ccnc4ccccc34)[C@@H](O)C2)n1 |
| InChI | InChI=1S/C22H23N3O3/c1-28-22(27)20-8-4-5-17(24-20)13-25-12-16(21(26)14-25)11-15-9-10-23-19-7-3-2-6-18(15)19/h2-10,16,21,26H,11-14H2,1H3/t16-,21+/m1/s1 |
| InChIKey | RVRPUGGJNHXWIH-IERDGZPVSA-N |
| XLogP | 2.45 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate (CID 155498400) is methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate is COC(=O)c1cccc(CN2C[C@@H](Cc3ccnc4ccccc34)[C@@H](O)C2)n1.
What is the InChIKey of methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate?
The InChIKey is RVRPUGGJNHXWIH-IERDGZPVSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-28-22(27)20-8-4-5-17(24-20)13-25-12-16(21(26)14-25)11-15-9-10-23-19-7-3-2-6-18(15)19/h2-10,16,21,26H,11-14H2,1H3/t16-,21+/m1/s1.
What are the key properties of methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate?
methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate has a molecular weight of 377.44 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[(3R,4R)-3-hydroxy-4-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate is sourced from PubChem (CID 155498400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).