C12H14FN3OS — CID 135109642
5-fluoro-4-methoxy-N-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-amine (PubChem CID 135109642) has the molecular formula C12H14FN3OS and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-N-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-methoxy-N-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 135109642 |
| Molecular Formula | C12H14FN3OS |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-fluoro-4-methoxy-N-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-amine |
| SMILES | COc1nc(NC(C)Cc2cccs2)ncc1F |
| InChI | InChI=1S/C12H14FN3OS/c1-8(6-9-4-3-5-18-9)15-12-14-7-10(13)11(16-12)17-2/h3-5,7-8H,6H2,1-2H3,(H,14,15,16) |
| InChIKey | LNVCKTHVZPSCNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |