C22H34N2O — CID 135109711
(4R,5R)-4-methoxy-7-[1-(4-methylphenyl)piperidin-4-yl]-7-azaspiro[4.5]decane (PubChem CID 135109711) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (4R,5R)-4-methoxy-7-[1-(4-methylphenyl)piperidin-4-yl]-7-azaspiro[4.5]decane.
| Compound Name | (4R,5R)-4-methoxy-7-[1-(4-methylphenyl)piperidin-4-yl]-7-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 135109711 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (4R,5R)-4-methoxy-7-[1-(4-methylphenyl)piperidin-4-yl]-7-azaspiro[4.5]decane |
| SMILES | CO[C@@H]1CCC[C@]12CCCN(C1CCN(c3ccc(C)cc3)CC1)C2 |
| InChI | InChI=1S/C22H34N2O/c1-18-6-8-19(9-7-18)23-15-10-20(11-16-23)24-14-4-13-22(17-24)12-3-5-21(22)25-2/h6-9,20-21H,3-5,10-17H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | NPVXIFBHWZKVJD-FGZHOGPDSA-N |
| XLogP | 4.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|