About 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane
9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane (PubChem CID 45222559) has the molecular formula C23H37N3O2
and a molecular weight of 387.57 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane |
| PubChem CID | 45222559 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane |
| SMILES | COCCN1CCCC2(CCN(C3CCN(c4ccc(OC)cc4)CC3)C2)C1 |
| InChI | InChI=1S/C23H37N3O2/c1-27-17-16-24-12-3-10-23(18-24)11-15-26(19-23)21-8-13-25(14-9-21)20-4-6-22(28-2)7-5-20/h4-7,21H,3,8-19H2,1-2H3 |
| InChIKey | ZRKBAWRFZBWEOF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane?
The IUPAC name of 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane (CID 45222559) is 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane?
The canonical SMILES for 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane is COCCN1CCCC2(CCN(C3CCN(c4ccc(OC)cc4)CC3)C2)C1.
What is the InChIKey of 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane?
The InChIKey is ZRKBAWRFZBWEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37N3O2/c1-27-17-16-24-12-3-10-23(18-24)11-15-26(19-23)21-8-13-25(14-9-21)20-4-6-22(28-2)7-5-20/h4-7,21H,3,8-19H2,1-2H3.
What are the key properties of 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane?
9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane has a molecular weight of 387.57 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 45222559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).