C23H37N3O2 — CID 45222559
9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane (PubChem CID 45222559) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane.
| Compound Name | 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 45222559 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 9-(2-methoxyethyl)-2-[1-(4-methoxyphenyl)piperidin-4-yl]-2,9-diazaspiro[4.5]decane |
| SMILES | COCCN1CCCC2(CCN(C3CCN(c4ccc(OC)cc4)CC3)C2)C1 |
| InChI | InChI=1S/C23H37N3O2/c1-27-17-16-24-12-3-10-23(18-24)11-15-26(19-23)21-8-13-25(14-9-21)20-4-6-22(28-2)7-5-20/h4-7,21H,3,8-19H2,1-2H3 |
| InChIKey | ZRKBAWRFZBWEOF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|